C17H18N2O3S — CID 86577101
6-methyl-N-(2,3,4-trimethoxyphenyl)-1,3-benzothiazol-2-amine (PubChem CID 86577101) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 6-methyl-N-(2,3,4-trimethoxyphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-methyl-N-(2,3,4-trimethoxyphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 86577101 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 6-methyl-N-(2,3,4-trimethoxyphenyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc(Nc2nc3ccc(C)cc3s2)c(OC)c1OC |
| InChI | InChI=1S/C17H18N2O3S/c1-10-5-6-11-14(9-10)23-17(18-11)19-12-7-8-13(20-2)16(22-4)15(12)21-3/h5-9H,1-4H3,(H,18,19) |
| InChIKey | TZIRLWKJFOTTEM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |