C13H10ClN3S — CID 87379371
N-(6-chloro-2-pyridinyl)-6-methyl-1,3-benzothiazol-2-amine (PubChem CID 87379371) has the molecular formula C13H10ClN3S and a molecular weight of 275.76 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-6-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(6-chloro-2-pyridinyl)-6-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 87379371 |
| Molecular Formula | C13H10ClN3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-6-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2nc(Nc3cccc(Cl)n3)sc2c1 |
| InChI | InChI=1S/C13H10ClN3S/c1-8-5-6-9-10(7-8)18-13(15-9)17-12-4-2-3-11(14)16-12/h2-7H,1H3,(H,15,16,17) |
| InChIKey | ZBARTIJSEDPPJD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|