C14H10FIN2OS — CID 79765855
N-(4-fluoro-2-iodophenyl)-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 79765855) has the molecular formula C14H10FIN2OS and a molecular weight of 400.22 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(4-fluoro-2-iodophenyl)-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79765855 |
| Molecular Formula | C14H10FIN2OS |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nc3ccc(F)cc3I)sc2c1 |
| InChI | InChI=1S/C14H10FIN2OS/c1-19-9-3-5-12-13(7-9)20-14(18-12)17-11-4-2-8(15)6-10(11)16/h2-7H,1H3,(H,17,18) |
| InChIKey | HTNPUQLCVAZHNP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|