C14H10ClFN2OS — CID 107368348
N-(3-chloro-5-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 107368348) has the molecular formula C14H10ClFN2OS and a molecular weight of 308.77 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(3-chloro-5-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 107368348 |
| Molecular Formula | C14H10ClFN2OS |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nc3cc(F)cc(Cl)c3)sc2c1 |
| InChI | InChI=1S/C14H10ClFN2OS/c1-19-11-2-3-12-13(7-11)20-14(18-12)17-10-5-8(15)4-9(16)6-10/h2-7H,1H3,(H,17,18) |
| InChIKey | WECRFWPDJDDSMH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |