C13H7ClF2N2S — CID 107368358
N-(3-chloro-5-fluorophenyl)-5-fluoro-1,3-benzothiazol-2-amine (PubChem CID 107368358) has the molecular formula C13H7ClF2N2S and a molecular weight of 296.73 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-5-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | N-(3-chloro-5-fluorophenyl)-5-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 107368358 |
| Molecular Formula | C13H7ClF2N2S |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-5-fluoro-1,3-benzothiazol-2-amine |
| SMILES | Fc1cc(Cl)cc(Nc2nc3cc(F)ccc3s2)c1 |
| InChI | InChI=1S/C13H7ClF2N2S/c14-7-3-9(16)5-10(4-7)17-13-18-11-6-8(15)1-2-12(11)19-13/h1-6H,(H,17,18) |
| InChIKey | UFLOLBDUUFXHGK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |