C14H9FN2O2S — CID 43306395
N-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazol-2-amine (PubChem CID 43306395) has the molecular formula C14H9FN2O2S and a molecular weight of 288.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43306395 |
| Molecular Formula | C14H9FN2O2S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2sc(Nc3ccc4c(c3)OCO4)nc2c1 |
| InChI | InChI=1S/C14H9FN2O2S/c15-8-1-4-13-10(5-8)17-14(20-13)16-9-2-3-11-12(6-9)19-7-18-11/h1-6H,7H2,(H,16,17) |
| InChIKey | GFAZUPMLXRIFRP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |