C15H12N2O3S — CID 43968835
N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine (PubChem CID 43968835) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine.
| Compound Name | N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
|---|---|
| PubChem CID | 43968835 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
| SMILES | COc1ccc(Nc2nc3cc4c(cc3s2)OCO4)cc1 |
| InChI | InChI=1S/C15H12N2O3S/c1-18-10-4-2-9(3-5-10)16-15-17-11-6-12-13(20-8-19-12)7-14(11)21-15/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | JCLHPTLBVISMMG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |