C16H13N3O4S — CID 43953308
N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-methoxybenzohydrazide (PubChem CID 43953308) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-methoxybenzohydrazide.
| Compound Name | N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 43953308 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2nc3cc4c(cc3s2)OCO4)cc1 |
| InChI | InChI=1S/C16H13N3O4S/c1-21-10-4-2-9(3-5-10)15(20)18-19-16-17-11-6-12-13(23-8-22-12)7-14(11)24-16/h2-7H,8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | LZBSYENRFJOBQK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|