C17H15N3O5S — CID 43953324
N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2,6-dimethoxybenzohydrazide (PubChem CID 43953324) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2,6-dimethoxybenzohydrazide.
| Compound Name | N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2,6-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 43953324 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N'-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2,6-dimethoxybenzohydrazide |
| SMILES | COc1cccc(OC)c1C(=O)NNc1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C17H15N3O5S/c1-22-10-4-3-5-11(23-2)15(10)16(21)19-20-17-18-9-6-12-13(25-8-24-12)7-14(9)26-17/h3-7H,8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | WWPYRZVMNRGLGJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|