C17H18N4O2S — CID 43953148
4-(dimethylamino)-N'-(6-methoxy-1,3-benzothiazol-2-yl)benzohydrazide (PubChem CID 43953148) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-(dimethylamino)-N'-(6-methoxy-1,3-benzothiazol-2-yl)benzohydrazide.
| Compound Name | 4-(dimethylamino)-N'-(6-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 43953148 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-(dimethylamino)-N'-(6-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
| SMILES | COc1ccc2nc(NNC(=O)c3ccc(N(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C17H18N4O2S/c1-21(2)12-6-4-11(5-7-12)16(22)19-20-17-18-14-9-8-13(23-3)10-15(14)24-17/h4-10H,1-3H3,(H,18,20)(H,19,22) |
| InChIKey | CRLBTHOINOOVTR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|