C23H21N3O3S2 — CID 139506275
N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxy-N-methylanilino)sulfanylbenzamide (PubChem CID 139506275) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxy-N-methylanilino)sulfanylbenzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxy-N-methylanilino)sulfanylbenzamide |
|---|---|
| PubChem CID | 139506275 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxy-N-methylanilino)sulfanylbenzamide |
| SMILES | COc1ccc(N(C)Sc2ccc(C(=O)Nc3nc4ccc(OC)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O3S2/c1-26(16-6-8-17(28-2)9-7-16)31-19-11-4-15(5-12-19)22(27)25-23-24-20-13-10-18(29-3)14-21(20)30-23/h4-14H,1-3H3,(H,24,25,27) |
| InChIKey | VHNKVOZGCGFJAN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|