C16H13N3O3 — CID 66554700
N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine (PubChem CID 66554700) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine.
| Compound Name | N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 66554700 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(4-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
| SMILES | COc1ccc(Nc2ncnc3cc4c(cc23)OCO4)cc1 |
| InChI | InChI=1S/C16H13N3O3/c1-20-11-4-2-10(3-5-11)19-16-12-6-14-15(22-9-21-14)7-13(12)17-8-18-16/h2-8H,9H2,1H3,(H,17,18,19) |
| InChIKey | IXOCTTRINIADBW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |