C15H14N3O4PS — CID 154673012
N-(4-dihydroxyphosphinothioyloxyphenyl)-7-methoxyquinazolin-4-amine (PubChem CID 154673012) has the molecular formula C15H14N3O4PS and a molecular weight of 363.34 g/mol. Its IUPAC name is N-(4-dihydroxyphosphinothioyloxyphenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | N-(4-dihydroxyphosphinothioyloxyphenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 154673012 |
| Molecular Formula | C15H14N3O4PS |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-(4-dihydroxyphosphinothioyloxyphenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1ccc2c(Nc3ccc(OP(O)(O)=S)cc3)ncnc2c1 |
| InChI | InChI=1S/C15H14N3O4PS/c1-21-12-6-7-13-14(8-12)16-9-17-15(13)18-10-2-4-11(5-3-10)22-23(19,20)24/h2-9H,1H3,(H,16,17,18)(H2,19,20,24) |
| InChIKey | ZCTZOVNTLLDEPQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|