C25H32N6O — CID 141331547
7-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]phenyl]quinazolin-4-amine (PubChem CID 141331547) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is 7-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]phenyl]quinazolin-4-amine.
| Compound Name | 7-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 141331547 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 7-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]phenyl]quinazolin-4-amine |
| SMILES | COc1ccc2c(Nc3ccc(N4CCN(C5CCN(C)CC5)CC4)cc3)ncnc2c1 |
| InChI | InChI=1S/C25H32N6O/c1-29-11-9-21(10-12-29)31-15-13-30(14-16-31)20-5-3-19(4-6-20)28-25-23-8-7-22(32-2)17-24(23)26-18-27-25/h3-8,17-18,21H,9-16H2,1-2H3,(H,26,27,28) |
| InChIKey | XMVBUHGBYUKONN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|