C17H18N3O4P — CID 155033674
2-[4-[(7-methoxyquinazolin-4-yl)amino]phenyl]ethylphosphonic acid (PubChem CID 155033674) has the molecular formula C17H18N3O4P and a molecular weight of 359.32 g/mol. Its IUPAC name is 2-[4-[(7-methoxyquinazolin-4-yl)amino]phenyl]ethylphosphonic acid.
| Compound Name | 2-[4-[(7-methoxyquinazolin-4-yl)amino]phenyl]ethylphosphonic acid |
|---|---|
| PubChem CID | 155033674 |
| Molecular Formula | C17H18N3O4P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[4-[(7-methoxyquinazolin-4-yl)amino]phenyl]ethylphosphonic acid |
| SMILES | COc1ccc2c(Nc3ccc(CCP(=O)(O)O)cc3)ncnc2c1 |
| InChI | InChI=1S/C17H18N3O4P/c1-24-14-6-7-15-16(10-14)18-11-19-17(15)20-13-4-2-12(3-5-13)8-9-25(21,22)23/h2-7,10-11H,8-9H2,1H3,(H,18,19,20)(H2,21,22,23) |
| InChIKey | GTVBBEXNGVKDRP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|