C16H11ClN4O — CID 175390232
2-chloro-4-[(7-methoxyquinazolin-4-yl)amino]benzonitrile (PubChem CID 175390232) has the molecular formula C16H11ClN4O and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-chloro-4-[(7-methoxyquinazolin-4-yl)amino]benzonitrile.
| Compound Name | 2-chloro-4-[(7-methoxyquinazolin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 175390232 |
| Molecular Formula | C16H11ClN4O |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-chloro-4-[(7-methoxyquinazolin-4-yl)amino]benzonitrile |
| SMILES | COc1ccc2c(Nc3ccc(C#N)c(Cl)c3)ncnc2c1 |
| InChI | InChI=1S/C16H11ClN4O/c1-22-12-4-5-13-15(7-12)19-9-20-16(13)21-11-3-2-10(8-18)14(17)6-11/h2-7,9H,1H3,(H,19,20,21) |
| InChIKey | GQLFIZLNUUMFFQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |