C20H20ClN3O — CID 146055680
7-methoxy-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride (PubChem CID 146055680) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 7-methoxy-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride.
| Compound Name | 7-methoxy-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 146055680 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 7-methoxy-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride |
| SMILES | COc1ccc2c(Nc3ccc(C(C)C)cc3)c(C#N)cnc2c1.Cl |
| InChI | InChI=1S/C20H19N3O.ClH/c1-13(2)14-4-6-16(7-5-14)23-20-15(11-21)12-22-19-10-17(24-3)8-9-18(19)20;/h4-10,12-13H,1-3H3,(H,22,23);1H |
| InChIKey | BDFRNQIKFHIKBQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |