C20H20ClN3 — CID 146055600
6-methyl-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride (PubChem CID 146055600) has the molecular formula C20H20ClN3 and a molecular weight of 337.85 g/mol. Its IUPAC name is 6-methyl-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride.
| Compound Name | 6-methyl-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 146055600 |
| Molecular Formula | C20H20ClN3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-methyl-4-(4-propan-2-ylanilino)quinoline-3-carbonitrile;hydrochloride |
| SMILES | Cc1ccc2ncc(C#N)c(Nc3ccc(C(C)C)cc3)c2c1.Cl |
| InChI | InChI=1S/C20H19N3.ClH/c1-13(2)15-5-7-17(8-6-15)23-20-16(11-21)12-22-19-9-4-14(3)10-18(19)20;/h4-10,12-13H,1-3H3,(H,22,23);1H |
| InChIKey | YNGLLKGKHNDOMJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |