C15H12N2O2S2 — CID 43969103
N-(1,3-benzodioxol-5-yl)-4-methylsulfanyl-1,3-benzothiazol-2-amine (PubChem CID 43969103) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-methylsulfanyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-methylsulfanyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43969103 |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-methylsulfanyl-1,3-benzothiazol-2-amine |
| SMILES | CSc1cccc2sc(Nc3ccc4c(c3)OCO4)nc12 |
| InChI | InChI=1S/C15H12N2O2S2/c1-20-12-3-2-4-13-14(12)17-15(21-13)16-9-5-6-10-11(7-9)19-8-18-10/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | WBEQCQXYXJKWBF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |