C16H14N2O2S — CID 28832815
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-benzothiazol-2-amine (PubChem CID 28832815) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 28832815 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-benzothiazol-2-amine |
| SMILES | c1ccc2sc(Nc3ccc4c(c3)OCCCO4)nc2c1 |
| InChI | InChI=1S/C16H14N2O2S/c1-2-5-15-12(4-1)18-16(21-15)17-11-6-7-13-14(10-11)20-9-3-8-19-13/h1-2,4-7,10H,3,8-9H2,(H,17,18) |
| InChIKey | OAVWOGRWZVMMKV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |