C18H12N6O4S — CID 23480612
6-N-(1,3-benzodioxol-5-yl)-4-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23480612) has the molecular formula C18H12N6O4S and a molecular weight of 408.40 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-yl)-4-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-yl)-4-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23480612 |
| Molecular Formula | C18H12N6O4S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-yl)-4-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc3c(c2)OCO3)ncnc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H12N6O4S/c25-24(26)15-16(21-10-5-6-12-13(7-10)28-9-27-12)19-8-20-17(15)23-18-22-11-3-1-2-4-14(11)29-18/h1-8H,9H2,(H2,19,20,21,22,23) |
| InChIKey | IAEVXKRGRBCEKC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|