C20H16N6O4S — CID 22530538
6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22530538) has the molecular formula C20H16N6O4S and a molecular weight of 436.45 g/mol. Its IUPAC name is 6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22530538 |
| Molecular Formula | C20H16N6O4S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc2nc(Nc3ncnc(Nc4ccc5c(c4)OCCO5)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C20H16N6O4S/c1-11-2-4-13-16(8-11)31-20(24-13)25-19-17(26(27)28)18(21-10-22-19)23-12-3-5-14-15(9-12)30-7-6-29-14/h2-5,8-10H,6-7H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | LOOKGAHLZRUJTR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|