C17H13N7O6 — CID 23480600
N-(1,3-benzodioxol-5-yl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine (PubChem CID 23480600) has the molecular formula C17H13N7O6 and a molecular weight of 411.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23480600 |
| Molecular Formula | C17H13N7O6 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(NNc2ncnc(Nc3ccc4c(c3)OCO4)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N7O6/c25-23(26)12-4-1-10(2-5-12)21-22-17-15(24(27)28)16(18-8-19-17)20-11-3-6-13-14(7-11)30-9-29-13/h1-8,21H,9H2,(H2,18,19,20,22) |
| InChIKey | WMHFUEWBPQDCTM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|