C17H11ClN4O4S — CID 23480553
N-(1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 23480553) has the molecular formula C17H11ClN4O4S and a molecular weight of 402.82 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23480553 |
| Molecular Formula | C17H11ClN4O4S |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc3c(c2)OCO3)ncnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClN4O4S/c18-10-1-4-12(5-2-10)27-17-15(22(23)24)16(19-8-20-17)21-11-3-6-13-14(7-11)26-9-25-13/h1-8H,9H2,(H,19,20,21) |
| InChIKey | LUOYUACFKCCCQL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|