C17H12Cl2N4O2S — CID 22534115
N-(2,4-dichlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 22534115) has the molecular formula C17H12Cl2N4O2S and a molecular weight of 407.28 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,4-dichlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22534115 |
| Molecular Formula | C17H12Cl2N4O2S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | N-(2,4-dichlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(Sc2ncnc(Nc3ccc(Cl)cc3Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12Cl2N4O2S/c1-10-2-5-12(6-3-10)26-17-15(23(24)25)16(20-9-21-17)22-14-7-4-11(18)8-13(14)19/h2-9H,1H3,(H,20,21,22) |
| InChIKey | QGGMBEHXEAFXJC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|