C15H9Cl2N5O2S — CID 23488638
6-(4-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine (PubChem CID 23488638) has the molecular formula C15H9Cl2N5O2S and a molecular weight of 394.24 g/mol. Its IUPAC name is 6-(4-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23488638 |
| Molecular Formula | C15H9Cl2N5O2S |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 6-(4-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccnc2Cl)ncnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H9Cl2N5O2S/c16-9-3-5-10(6-4-9)25-15-12(22(23)24)14(19-8-20-15)21-11-2-1-7-18-13(11)17/h1-8H,(H,19,20,21) |
| InChIKey | FAMWACULTLAAIU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|