C23H17ClN4O2S — CID 23488554
N-benzhydryl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 23488554) has the molecular formula C23H17ClN4O2S and a molecular weight of 448.94 g/mol. Its IUPAC name is N-benzhydryl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-benzhydryl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23488554 |
| Molecular Formula | C23H17ClN4O2S |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-benzhydryl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NC(c2ccccc2)c2ccccc2)ncnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN4O2S/c24-18-11-13-19(14-12-18)31-23-21(28(29)30)22(25-15-26-23)27-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,20H,(H,25,26,27) |
| InChIKey | FEAIUEYMDYWUQO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|