C16H13ClN4O2S2 — CID 23488645
6-(4-chlorophenyl)sulfanyl-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine (PubChem CID 23488645) has the molecular formula C16H13ClN4O2S2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 6-(4-chlorophenyl)sulfanyl-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-(4-chlorophenyl)sulfanyl-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23488645 |
| Molecular Formula | C16H13ClN4O2S2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 6-(4-chlorophenyl)sulfanyl-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCCc2cccs2)ncnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN4O2S2/c17-11-3-5-13(6-4-11)25-16-14(21(22)23)15(19-10-20-16)18-8-7-12-2-1-9-24-12/h1-6,9-10H,7-8H2,(H,18,19,20) |
| InChIKey | ZHPSPKRNGDMXNI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|