C22H19N7O2S — CID 22529151
5-nitro-4-N-(4-phenyldiazenylphenyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,6-diamine (PubChem CID 22529151) has the molecular formula C22H19N7O2S and a molecular weight of 445.51 g/mol. Its IUPAC name is 5-nitro-4-N-(4-phenyldiazenylphenyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N-(4-phenyldiazenylphenyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22529151 |
| Molecular Formula | C22H19N7O2S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 5-nitro-4-N-(4-phenyldiazenylphenyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCc2cccs2)ncnc1Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N7O2S/c30-29(31)20-21(23-13-12-19-7-4-14-32-19)24-15-25-22(20)26-16-8-10-18(11-9-16)28-27-17-5-2-1-3-6-17/h1-11,14-15H,12-13H2,(H2,23,24,25,26)/b28-27+ |
| InChIKey | FMDSWVVKBVQRDC-BYYHNAKLSA-N |
| XLogP | 6.26 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|