C29H23N7O2 — CID 22529060
4-N-benzhydryl-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine (PubChem CID 22529060) has the molecular formula C29H23N7O2 and a molecular weight of 501.55 g/mol. Its IUPAC name is 4-N-benzhydryl-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-benzhydryl-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22529060 |
| Molecular Formula | C29H23N7O2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 4-N-benzhydryl-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(/N=N/c3ccccc3)cc2)ncnc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23N7O2/c37-36(38)27-28(32-23-16-18-25(19-17-23)35-34-24-14-8-3-9-15-24)30-20-31-29(27)33-26(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-20,26H,(H2,30,31,32,33)/b35-34+ |
| InChIKey | VKZCQKJVMBDOCE-XAHDOWKMSA-N |
| XLogP | 7.75 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|