C23H18ClN7O3 — CID 23484637
4-N-(5-chloro-2-methoxyphenyl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine (PubChem CID 23484637) has the molecular formula C23H18ClN7O3 and a molecular weight of 475.90 g/mol. Its IUPAC name is 4-N-(5-chloro-2-methoxyphenyl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-chloro-2-methoxyphenyl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23484637 |
| Molecular Formula | C23H18ClN7O3 |
| Molecular Weight | 475.90 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 4-N-(5-chloro-2-methoxyphenyl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(Cl)cc1Nc1ncnc(Nc2ccc(/N=N/c3ccccc3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18ClN7O3/c1-34-20-12-7-15(24)13-19(20)28-23-21(31(32)33)22(25-14-26-23)27-16-8-10-18(11-9-16)30-29-17-5-3-2-4-6-17/h2-14H,1H3,(H2,25,26,27,28)/b30-29+ |
| InChIKey | QVOLAXFZHQLXAJ-QVIHXGFCSA-N |
| XLogP | 6.95 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|