C21H22ClN5O4 — CID 23484611
6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23484611) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23484611 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(Nc3cc(Cl)ccc3OC)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22ClN5O4/c1-3-4-11-31-16-8-6-15(7-9-16)25-20-19(27(28)29)21(24-13-23-20)26-17-12-14(22)5-10-18(17)30-2/h5-10,12-13H,3-4,11H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | AFKSUXQTESOZHB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|