C24H18N6O2S — CID 22528526
4-N-benzhydryl-6-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22528526) has the molecular formula C24H18N6O2S and a molecular weight of 454.52 g/mol. Its IUPAC name is 4-N-benzhydryl-6-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-benzhydryl-6-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22528526 |
| Molecular Formula | C24H18N6O2S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 4-N-benzhydryl-6-N-(1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2nc3ccccc3s2)ncnc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18N6O2S/c31-30(32)21-22(28-20(16-9-3-1-4-10-16)17-11-5-2-6-12-17)25-15-26-23(21)29-24-27-18-13-7-8-14-19(18)33-24/h1-15,20H,(H2,25,26,27,28,29) |
| InChIKey | ZHRZCABFVOSIJS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|