C18H11F3N6O2S — CID 23484201
4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine (PubChem CID 23484201) has the molecular formula C18H11F3N6O2S and a molecular weight of 432.39 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23484201 |
| Molecular Formula | C18H11F3N6O2S |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2nc3ccccc3s2)ncnc1Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H11F3N6O2S/c19-18(20,21)10-5-1-2-6-11(10)24-15-14(27(28)29)16(23-9-22-15)26-17-25-12-7-3-4-8-13(12)30-17/h1-9H,(H2,22,23,24,25,26) |
| InChIKey | OUKAJYILABBHBF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|