C19H16N6O2S — CID 23477994
6-N-(1,3-benzothiazol-2-yl)-4-N-benzyl-4-N-methyl-5-nitropyrimidine-4,6-diamine (PubChem CID 23477994) has the molecular formula C19H16N6O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is 6-N-(1,3-benzothiazol-2-yl)-4-N-benzyl-4-N-methyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzothiazol-2-yl)-4-N-benzyl-4-N-methyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23477994 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 6-N-(1,3-benzothiazol-2-yl)-4-N-benzyl-4-N-methyl-5-nitropyrimidine-4,6-diamine |
| SMILES | CN(Cc1ccccc1)c1ncnc(Nc2nc3ccccc3s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N6O2S/c1-24(11-13-7-3-2-4-8-13)18-16(25(26)27)17(20-12-21-18)23-19-22-14-9-5-6-10-15(14)28-19/h2-10,12H,11H2,1H3,(H,20,21,22,23) |
| InChIKey | HVPDRLSMVQYDHB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|