C18H21N7O2S — CID 22526031
4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine (PubChem CID 22526031) has the molecular formula C18H21N7O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526031 |
| Molecular Formula | C18H21N7O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCCCC2)ncnc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H21N7O2S/c26-25(27)15-16(19-8-11-24-9-4-1-5-10-24)20-12-21-17(15)23-18-22-13-6-2-3-7-14(13)28-18/h2-3,6-7,12H,1,4-5,8-11H2,(H2,19,20,21,22,23) |
| InChIKey | DHVCGDDBZMCNHP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|