C21H20N6O4S — CID 23480145
4-N-(1,3-benzothiazol-2-yl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 23480145) has the molecular formula C21H20N6O4S and a molecular weight of 452.50 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23480145 |
| Molecular Formula | C21H20N6O4S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc(CCNc2ncnc(Nc3nc4ccccc4s3)c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H20N6O4S/c1-30-15-8-7-13(11-16(15)31-2)9-10-22-19-18(27(28)29)20(24-12-23-19)26-21-25-14-5-3-4-6-17(14)32-21/h3-8,11-12H,9-10H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | KYTSLWBKSDONMI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|