C22H23N5O6 — CID 23480177
methyl 4-[[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 23480177) has the molecular formula C22H23N5O6 and a molecular weight of 453.46 g/mol. Its IUPAC name is methyl 4-[[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23480177 |
| Molecular Formula | C22H23N5O6 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | methyl 4-[[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(NCCc3ccc(OC)c(OC)c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23N5O6/c1-31-17-9-4-14(12-18(17)32-2)10-11-23-20-19(27(29)30)21(25-13-24-20)26-16-7-5-15(6-8-16)22(28)33-3/h4-9,12-13H,10-11H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | GAUUNYJHWZZTAS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|