C21H21ClN6O5 — CID 23480194
4-chloro-N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23480194) has the molecular formula C21H21ClN6O5 and a molecular weight of 472.89 g/mol. Its IUPAC name is 4-chloro-N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-chloro-N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23480194 |
| Molecular Formula | C21H21ClN6O5 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 4-chloro-N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccc(CCNc2ncnc(NNC(=O)c3ccc(Cl)cc3)c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H21ClN6O5/c1-32-16-8-3-13(11-17(16)33-2)9-10-23-19-18(28(30)31)20(25-12-24-19)26-27-21(29)14-4-6-15(22)7-5-14/h3-8,11-12H,9-10H2,1-2H3,(H,27,29)(H2,23,24,25,26) |
| InChIKey | SNNQMSWXFJHBIY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|