C19H17ClN6O4 — CID 23494665
4-chloro-N'-[6-[(4-methoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23494665) has the molecular formula C19H17ClN6O4 and a molecular weight of 428.84 g/mol. Its IUPAC name is 4-chloro-N'-[6-[(4-methoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-chloro-N'-[6-[(4-methoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23494665 |
| Molecular Formula | C19H17ClN6O4 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 4-chloro-N'-[6-[(4-methoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccc(CNc2ncnc(NNC(=O)c3ccc(Cl)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17ClN6O4/c1-30-15-8-2-12(3-9-15)10-21-17-16(26(28)29)18(23-11-22-17)24-25-19(27)13-4-6-14(20)7-5-13/h2-9,11H,10H2,1H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | DBLBPUAZCYNMTA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|