C22H25N5O6 — CID 23480122
4-N-(2,4-dimethoxyphenyl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 23480122) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is 4-N-(2,4-dimethoxyphenyl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,4-dimethoxyphenyl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23480122 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-N-(2,4-dimethoxyphenyl)-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2ncnc(NCCc3ccc(OC)c(OC)c3)c2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C22H25N5O6/c1-30-15-6-7-16(18(12-15)32-3)26-22-20(27(28)29)21(24-13-25-22)23-10-9-14-5-8-17(31-2)19(11-14)33-4/h5-8,11-13H,9-10H2,1-4H3,(H2,23,24,25,26) |
| InChIKey | KIQPUCCBLGKGOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|