C20H19N7O7 — CID 23495002
N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide (PubChem CID 23495002) has the molecular formula C20H19N7O7 and a molecular weight of 469.41 g/mol. Its IUPAC name is N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide.
| Compound Name | N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide |
|---|---|
| PubChem CID | 23495002 |
| Molecular Formula | C20H19N7O7 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide |
| SMILES | COc1ccc(Nc2ncnc(NNC(=O)Cc3ccc([N+](=O)[O-])cc3)c2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C20H19N7O7/c1-33-14-7-8-15(16(10-14)34-2)23-19-18(27(31)32)20(22-11-21-19)25-24-17(28)9-12-3-5-13(6-4-12)26(29)30/h3-8,10-11H,9H2,1-2H3,(H,24,28)(H2,21,22,23,25) |
| InChIKey | FKCSRFHJHLKQTJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|