C19H17N7O7 — CID 23494986
N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide (PubChem CID 23494986) has the molecular formula C19H17N7O7 and a molecular weight of 455.39 g/mol. Its IUPAC name is N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide.
| Compound Name | N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23494986 |
| Molecular Formula | C19H17N7O7 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N'-[6-(2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide |
| SMILES | COc1ccc(Nc2ncnc(NNC(=O)c3ccccc3[N+](=O)[O-])c2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C19H17N7O7/c1-32-11-7-8-13(15(9-11)33-2)22-17-16(26(30)31)18(21-10-20-17)23-24-19(27)12-5-3-4-6-14(12)25(28)29/h3-10H,1-2H3,(H,24,27)(H2,20,21,22,23) |
| InChIKey | RYMLXIFKCFLYRR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|