C19H17BrN6O4 — CID 23480435
2-bromo-N'-[6-(2-methoxy-5-methylanilino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23480435) has the molecular formula C19H17BrN6O4 and a molecular weight of 473.29 g/mol. Its IUPAC name is 2-bromo-N'-[6-(2-methoxy-5-methylanilino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-bromo-N'-[6-(2-methoxy-5-methylanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23480435 |
| Molecular Formula | C19H17BrN6O4 |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 2-bromo-N'-[6-(2-methoxy-5-methylanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccc(C)cc1Nc1ncnc(NNC(=O)c2ccccc2Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17BrN6O4/c1-11-7-8-15(30-2)14(9-11)23-17-16(26(28)29)18(22-10-21-17)24-25-19(27)12-5-3-4-6-13(12)20/h3-10H,1-2H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | VTQMHNGDSYGHLW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|