C20H20N6O6 — CID 23494833
N'-[6-(2,5-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide (PubChem CID 23494833) has the molecular formula C20H20N6O6 and a molecular weight of 440.42 g/mol. Its IUPAC name is N'-[6-(2,5-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide.
| Compound Name | N'-[6-(2,5-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 23494833 |
| Molecular Formula | C20H20N6O6 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N'-[6-(2,5-dimethoxyanilino)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
| SMILES | COc1ccc(OC)c(Nc2ncnc(NNC(=O)c3ccccc3OC)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N6O6/c1-30-12-8-9-16(32-3)14(10-12)23-18-17(26(28)29)19(22-11-21-18)24-25-20(27)13-6-4-5-7-15(13)31-2/h4-11H,1-3H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | BUWNQBFENKMCPP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 149.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|