C16H21N5O5 — CID 23494920
4-N-(2,4-dimethoxyphenyl)-6-N-(3-methoxypropyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23494920) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 4-N-(2,4-dimethoxyphenyl)-6-N-(3-methoxypropyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,4-dimethoxyphenyl)-6-N-(3-methoxypropyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23494920 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-N-(2,4-dimethoxyphenyl)-6-N-(3-methoxypropyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCCCNc1ncnc(Nc2ccc(OC)cc2OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N5O5/c1-24-8-4-7-17-15-14(21(22)23)16(19-10-18-15)20-12-6-5-11(25-2)9-13(12)26-3/h5-6,9-10H,4,7-8H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | OVLVCYMWQURXCI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|