C22H18N6O2 — CID 23482022
4-N-benzhydryl-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine (PubChem CID 23482022) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-N-benzhydryl-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-benzhydryl-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23482022 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-N-benzhydryl-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccncc2)ncnc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N6O2/c29-28(30)20-21(26-18-11-13-23-14-12-18)24-15-25-22(20)27-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,19H,(H2,23,24,25,26,27) |
| InChIKey | GIRYOKDTBCAFQW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|