C22H16N6O2S — CID 22529055
5-nitro-N-(4-phenyldiazenylphenyl)-6-phenylsulfanylpyrimidin-4-amine (PubChem CID 22529055) has the molecular formula C22H16N6O2S and a molecular weight of 428.48 g/mol. Its IUPAC name is 5-nitro-N-(4-phenyldiazenylphenyl)-6-phenylsulfanylpyrimidin-4-amine.
| Compound Name | 5-nitro-N-(4-phenyldiazenylphenyl)-6-phenylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 22529055 |
| Molecular Formula | C22H16N6O2S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 5-nitro-N-(4-phenyldiazenylphenyl)-6-phenylsulfanylpyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(/N=N/c3ccccc3)cc2)ncnc1Sc1ccccc1 |
| InChI | InChI=1S/C22H16N6O2S/c29-28(30)20-21(23-15-24-22(20)31-19-9-5-2-6-10-19)25-16-11-13-18(14-12-16)27-26-17-7-3-1-4-8-17/h1-15H,(H,23,24,25)/b27-26+ |
| InChIKey | DHIDDRPITNDYLF-CYYJNZCTSA-N |
| XLogP | 6.70 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|