C17H15N5O2S — CID 22526673
1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2-phenylhydrazine (PubChem CID 22526673) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2-phenylhydrazine.
| Compound Name | 1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 22526673 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2-phenylhydrazine |
| SMILES | Cc1ccc(Sc2ncnc(NNc3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15N5O2S/c1-12-7-9-14(10-8-12)25-17-15(22(23)24)16(18-11-19-17)21-20-13-5-3-2-4-6-13/h2-11,20H,1H3,(H,18,19,21) |
| InChIKey | CYRBJXBFRXMCFY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|