C17H13ClN4O2S — CID 22532952
N-(4-chlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 22532952) has the molecular formula C17H13ClN4O2S and a molecular weight of 372.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(4-chlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22532952 |
| Molecular Formula | C17H13ClN4O2S |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | N-(4-chlorophenyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(Sc2ncnc(Nc3ccc(Cl)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13ClN4O2S/c1-11-2-8-14(9-3-11)25-17-15(22(23)24)16(19-10-20-17)21-13-6-4-12(18)5-7-13/h2-10H,1H3,(H,19,20,21) |
| InChIKey | RISWUHLHFMRSEF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|